What is the molecular formula of 3-Phenyl-2-chromenone?
The molecular formula is C15H10O2.
What is the molecular weight of 3-Phenyl-2-chromenone?
The molecular weight is 222.24 g/mol.
What is the IUPAC name of 3-Phenyl-2-chromenone?
The IUPAC name is 3-phenylchromen-2-one.
What is the structure of 3-Phenyl-2-chromenone?
The structure is not provided in the reference.
What are the synonyms of 3-Phenyl-2-chromenone?
The synonyms are 3-Phenylcoumarin, 3-Phenyl-2H-chromen-2-one, 955-10-2, and 3-phenylchromen-2-one.
What is the InChI of 3-Phenyl-2-chromenone?
The InChI is InChI=1S/C15H10O2/c16-15-13(11-6-2-1-3-7-11)10-12-8-4-5-9-14(12)17-15/h1-10H.
What is the InChIKey of 3-Phenyl-2-chromenone?
The InChIKey is HWDSXZLYIKESML-UHFFFAOYSA-N.
What is the Canonical SMILES of 3-Phenyl-2-chromenone?
The Canonical SMILES is C1=CC=C(C=C1)C2=CC3=CC=CC=C3OC2=O.
What is the CAS number of 3-Phenyl-2-chromenone?
The CAS number is 955-10-2.
What is the molecular weight of 3-Phenyl-2-chromenone according to PubChem?
The molecular weight is 222.24 g/mol according to PubChem.