What is the molecular formula of 4,7-Dichloro-isoindolin-1-one?
The molecular formula of 4,7-Dichloro-isoindolin-1-one is C8H5Cl2NO.
What are the synonyms for 4,7-Dichloro-isoindolin-1-one?
The synonyms for 4,7-Dichloro-isoindolin-1-one are 954239-40-8, 4,7-DICHLORO-ISOINDOLIN-1-ONE, 4,7-Dichloroisoindolin-1-one, and 4,7-dichloro-2,3-dihydroisoindol-1-one.
What is the molecular weight of 4,7-Dichloro-isoindolin-1-one?
The molecular weight of 4,7-Dichloro-isoindolin-1-one is 202.03 g/mol.
When was 4,7-Dichloro-isoindolin-1-one created?
4,7-Dichloro-isoindolin-1-one was created on October 30, 2011.
What is the IUPAC name of 4,7-Dichloro-isoindolin-1-one?
The IUPAC name of 4,7-Dichloro-isoindolin-1-one is 4,7-dichloro-2,3-dihydroisoindol-1-one.
What is the InChI code of 4,7-Dichloro-isoindolin-1-one?
The InChI code of 4,7-Dichloro-isoindolin-1-one is InChI=1S/C8H5Cl2NO/c9-5-1-2-6(10)7-4(5)3-11-8(7)12/h1-2H,3H2,(H,11,12).
What is the InChIKey of 4,7-Dichloro-isoindolin-1-one?
The InChIKey of 4,7-Dichloro-isoindolin-1-one is ASMYKHRMDUGONA-UHFFFAOYSA-N.
What is the canonical SMILES of 4,7-Dichloro-isoindolin-1-one?
The canonical SMILES of 4,7-Dichloro-isoindolin-1-one is C1C2=C(C=CC(=C2C(=O)N1)Cl)Cl.
What is the CAS number of 4,7-Dichloro-isoindolin-1-one?
The CAS number of 4,7-Dichloro-isoindolin-1-one is 954239-40-8.
※ Please kindly note that our products are for research use only.