What is the molecular formula of Chembrdg-bb 4022460?
The molecular formula of Chembrdg-bb 4022460 is C12H18N2O.
What is the molecular weight of Chembrdg-bb 4022460?
The molecular weight of Chembrdg-bb 4022460 is 206.28 g/mol.
What is the CAS number of Chembrdg-bb 4022460?
The CAS number of Chembrdg-bb 4022460 is 95380-42-0.
What is the IUPAC name of Chembrdg-bb 4022460?
The IUPAC name of Chembrdg-bb 4022460 is 2-[(4-methylpiperazin-1-yl)methyl]phenol.
What is the InChI of Chembrdg-bb 4022460?
The InChI of Chembrdg-bb 4022460 is InChI=1S/C12H18N2O/c1-13-6-8-14(9-7-13)10-11-4-2-3-5-12(11)15/h2-5,15H,6-10H2,1H3.
What is the InChIKey of Chembrdg-bb 4022460?
The InChIKey of Chembrdg-bb 4022460 is OBHRMGXZZMKBMC-UHFFFAOYSA-N.
What is the canonical SMILES of Chembrdg-bb 4022460?
The canonical SMILES of Chembrdg-bb 4022460 is CN1CCN(CC1)CC2=CC=CC=C2O.
What is the XLogP3 value of Chembrdg-bb 4022460?
The XLogP3 value of Chembrdg-bb 4022460 is 0.7.
How many hydrogen bond donor counts does Chembrdg-bb 4022460 have?
Chembrdg-bb 4022460 has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does Chembrdg-bb 4022460 have?
Chembrdg-bb 4022460 has 3 hydrogen bond acceptor counts.