What is the molecular formula of 3,4-Dimethoxyphenyl 2,3,4-trimethoxybenzoate?
The molecular formula of 3,4-Dimethoxyphenyl 2,3,4-trimethoxybenzoate is C18H20O7.
What is the IUPAC name of 3,4-Dimethoxyphenyl 2,3,4-trimethoxybenzoate?
The IUPAC name of 3,4-Dimethoxyphenyl 2,3,4-trimethoxybenzoate is (3,4-dimethoxyphenyl) 2,3,4-trimethoxybenzoate.
What is the molecular weight of 3,4-Dimethoxyphenyl 2,3,4-trimethoxybenzoate?
The molecular weight of 3,4-Dimethoxyphenyl 2,3,4-trimethoxybenzoate is 348.3 g/mol.
What is the InChI of 3,4-Dimethoxyphenyl 2,3,4-trimethoxybenzoate?
The InChI of 3,4-Dimethoxyphenyl 2,3,4-trimethoxybenzoate is InChI=1S/C18H20O7/c1-20-13-8-6-11(10-15(13)22-3)25-18(19)12-7-9-14(21-2)17(24-5)16(12)23-4/h6-10H,1-5H3.
What is the InChIKey of 3,4-Dimethoxyphenyl 2,3,4-trimethoxybenzoate?
The InChIKey of 3,4-Dimethoxyphenyl 2,3,4-trimethoxybenzoate is LDCMFZIDVAWOPU-UHFFFAOYSA-N.
How many hydrogen bond donor counts are there in 3,4-Dimethoxyphenyl 2,3,4-trimethoxybenzoate?
There are 0 hydrogen bond donor counts in 3,4-Dimethoxyphenyl 2,3,4-trimethoxybenzoate.
What is the topological polar surface area of 3,4-Dimethoxyphenyl 2,3,4-trimethoxybenzoate?
The topological polar surface area of 3,4-Dimethoxyphenyl 2,3,4-trimethoxybenzoate is 72.4 2.
How many defined atom stereocenter counts are there in 3,4-Dimethoxyphenyl 2,3,4-trimethoxybenzoate?
There are 0 defined atom stereocenter counts in 3,4-Dimethoxyphenyl 2,3,4-trimethoxybenzoate.
Is the compound canonicalized in 3,4-Dimethoxyphenyl 2,3,4-trimethoxybenzoate?
Yes, the compound is canonicalized in 3,4-Dimethoxyphenyl 2,3,4-trimethoxybenzoate.
What is the covalently-bonded unit count in 3,4-Dimethoxyphenyl 2,3,4-trimethoxybenzoate?
The covalently-bonded unit count in 3,4-Dimethoxyphenyl 2,3,4-trimethoxybenzoate is 1.