What is the molecular formula of Atovaquone?
The molecular formula of Atovaquone is C22H19ClO3.
What is the molecular weight of Atovaquone?
The molecular weight of Atovaquone is 366.8 g/mol.
What is the IUPAC name of Atovaquone?
The IUPAC name of Atovaquone is 3-[4-(4-chlorophenyl)cyclohexyl]-4-hydroxynaphthalene-1,2-dione.
What is the InChI of Atovaquone?
The InChI of Atovaquone is InChI=1S/C22H19ClO3/c23-16-11-9-14(10-12-16)13-5-7-15(8-6-13)19-20(24)17-3-1-2-4-18(17)21(25)22(19)26/h1-4,9-13,15,24H,5-8H2.
What is the InChIKey of Atovaquone?
The InChIKey of Atovaquone is BSJMWHQBCZFXBR-UHFFFAOYSA-N.
What is the canonical SMILES of Atovaquone?
The canonical SMILES of Atovaquone is C1CC(CCC1C2=CC=C(C=C2)Cl)C3=C(C4=CC=CC=C4C(=O)C3=O)O.
What is the CAS number of Atovaquone?
The CAS number of Atovaquone is 94015-53-9.
What is the UNII of Atovaquone?
The UNII of Atovaquone is Y883P1Z2LT.
What is the ChEMBL ID of Atovaquone?
The ChEMBL ID of Atovaquone is CHEMBL1450.
What is the RXCUI of Atovaquone?
The RXCUI of Atovaquone is 60212.