What is the PubChem CID of tiopronin?
The PubChem CID of tiopronin is 5483.
What is the molecular formula of tiopronin?
The molecular formula of tiopronin is C5H9NO3S.
What is the molecular weight of tiopronin?
The molecular weight of tiopronin is 163.20 g/mol.
What is the IUPAC name of tiopronin?
The IUPAC name of tiopronin is 2-(2-sulfanylpropanoylamino)acetic acid.
What is the InChI of tiopronin?
The InChI of tiopronin is InChI=1S/C5H9NO3S/c1-3(10)5(9)6-2-4(7)8/h3,10H,2H2,1H3,(H,6,9)(H,7,8).
What is the InChIKey of tiopronin?
The InChIKey of tiopronin is YTGJWQPHMWSCST-UHFFFAOYSA-N.
What are the synonyms of tiopronin?
The synonyms of tiopronin include N-(2-Mercaptopropionyl)glycine, Acadione, and Thiopronine.
What is the primary use of tiopronin?
Tiopronin is primarily used in the treatment of severe homozygous cystinuria to control the rate of cystine precipitation and excretion, and prevent kidney stone formation.
How is tiopronin dosed?
Tiopronin is dosed on an individual basis using close monitoring of urinary cystine concentrations and urinary output.
Is tiopronin patented in the United States?
No, tiopronin is not patented in the United States as it is classified as an orphan drug and used for a rare disease.