What is the molecular formula of 3-Aminobenzosuberone?
The molecular formula of 3-Aminobenzosuberone is C11H13NO.
When was 3-Aminobenzosuberone first created?
3-Aminobenzosuberone was first created on March 26, 2005.
What is the IUPAC name of 3-Aminobenzosuberone?
The IUPAC name of 3-Aminobenzosuberone is 3-amino-6,7,8,9-tetrahydrobenzo[7]annulen-5-one.
What is the molecular weight of 3-Aminobenzosuberone?
The molecular weight of 3-Aminobenzosuberone is 175.23 g/mol.
What is the Canonical SMILES representation of 3-Aminobenzosuberone?
The Canonical SMILES representation of 3-Aminobenzosuberone is C1CCC(=O)C2=C(C1)C=CC(=C2)N.
What is the InChIKey of 3-Aminobenzosuberone?
The InChIKey of 3-Aminobenzosuberone is ZQRDYXKTQPGKMC-UHFFFAOYSA-N.
How many hydrogen bond donor counts does 3-Aminobenzosuberone have?
3-Aminobenzosuberone has 1 hydrogen bond donor count.
What is the XLogP3-AA value of 3-Aminobenzosuberone?
The XLogP3-AA value of 3-Aminobenzosuberone is 1.9.
What is the exact mass of 3-Aminobenzosuberone?
The exact mass of 3-Aminobenzosuberone is 175.099714038 g/mol.
Is the compound canonicalized?
Yes, the compound is canonicalized.