What is the molecular formula of 3,5-Dichloro-2-hydroxybenzenesulfonic acid disodium salt?
The molecular formula of 3,5-Dichloro-2-hydroxybenzenesulfonic acid disodium salt is C6H4Cl2NaO4S.
What is the molecular weight of 3,5-Dichloro-2-hydroxybenzenesulfonic acid disodium salt?
The molecular weight of 3,5-Dichloro-2-hydroxybenzenesulfonic acid disodium salt is 266.05 g/mol.
What are the synonyms of 3,5-Dichloro-2-hydroxybenzenesulfonic acid disodium salt?
The synonyms of 3,5-Dichloro-2-hydroxybenzenesulfonic acid disodium salt are Hdcbs, disodium salt DHBS, 2-Hydroxy-3,5-dichlorobenzenesulphonic acid, disodium salt, SCHEMBL1648602, AKOS040744060.
What is the InChI of 3,5-Dichloro-2-hydroxybenzenesulfonic acid disodium salt?
The InChI of 3,5-Dichloro-2-hydroxybenzenesulfonic acid disodium salt is InChI=1S/C6H4Cl2O4S.Na/c7-3-1-4(8)6(9)5(2-3)13(10,11)12;/h1-2,9H,(H,10,11,12).
What is the InChIKey of 3,5-Dichloro-2-hydroxybenzenesulfonic acid disodium salt?
The InChIKey of 3,5-Dichloro-2-hydroxybenzenesulfonic acid disodium salt is VCILYNOSKHDKEM-UHFFFAOYSA-N.
What is the canonical SMILES of 3,5-Dichloro-2-hydroxybenzenesulfonic acid disodium salt?
The canonical SMILES of 3,5-Dichloro-2-hydroxybenzenesulfonic acid disodium salt is C1=C(C=C(C(=C1S(=O)(=O)O)O)Cl)Cl.[Na].
What is the CAS number of 3,5-Dichloro-2-hydroxybenzenesulfonic acid disodium salt?
The CAS number of 3,5-Dichloro-2-hydroxybenzenesulfonic acid disodium salt is 54970-72-8.
What is the compound name for the related CAS number of 3,5-Dichloro-2-hydroxybenzenesulfonic acid disodium salt?
The compound name for the related CAS number 95041-38-6 is Benzenesulfonic acid, 3,5-dichloro-2-hydroxy-, sodium salt (1:2).
How many hydrogen bond donor counts does 3,5-Dichloro-2-hydroxybenzenesulfonic acid disodium salt have?
3,5-Dichloro-2-hydroxybenzenesulfonic acid disodium salt has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 3,5-Dichloro-2-hydroxybenzenesulfonic acid disodium salt have?
3,5-Dichloro-2-hydroxybenzenesulfonic acid disodium salt has 4 hydrogen bond acceptor counts.
※ Please kindly note that our products are for research use only.
Download
![Acetamide,2-bromo-N-[2-[[3-[(2-cyano-1H-indol-4-yl)oxy]-2-hydroxypropyl]amino]-2-methylpropyl]-](https://resource.alfa-chemistry.com/structure/95034-01-8.gif)
