What is the PubChem CID of Sudan iii-d6?
The PubChem CID of Sudan iii-d6 is 71752252.
What is the molecular formula of Sudan iii-d6?
The molecular formula of Sudan iii-d6 is C22H16N4O.
What are the synonyms of Sudan iii-d6?
The synonyms of Sudan iii-d6 are 1-[[4-(Phenylazo)phenyl]azo]- 2-naphthalenol-d6 and 1-[2-[4-(2-Phenyldiazenyl)phenyl]diazenyl]-2-naphthalenol-d6.
What is the molecular weight of Sudan iii-d6?
The molecular weight of Sudan iii-d6 is 358.4 g/mol.
When was Sudan iii-d6 created?
Sudan iii-d6 was created on November 1, 2013.
When was Sudan iii-d6 last modified?
Sudan iii-d6 was last modified on December 30, 2023.
What is the IUPAC name of Sudan iii-d6?
The IUPAC name of Sudan iii-d6 is (1E)-3,4,5,6,7,8-hexadeuterio-1-[(4-phenyldiazenylphenyl)hydrazinylidene]naphthalen-2-one.
What is the InChI of Sudan iii-d6?
The InChI of Sudan iii-d6 is InChI=1S/C22H16N4O/c27-21-15-10-16-6-4-5-9-20(16)22(21)26-25-19-13-11-18(12-14-19)24-23-17-7-2-1-3-8-17/h1-15,25H/b24-23?,26-22+/i4D,5D,6D,9D,10D,15D.
What is the InChIKey of Sudan iii-d6?
The InChIKey of Sudan iii-d6 is HTPQPMPFXUWUOT-TZKTVLFWSA-N.
Is Sudan iii-d6 canonicalized?
Yes, Sudan iii-d6 is canonicalized.