What is the PubChem CID for Palisandal?
The PubChem CID for Palisandal is 70368.
What is the molecular formula of Palisandal?
The molecular formula of Palisandal is C14H28O2.
What is the molecular weight of Palisandal?
The molecular weight of Palisandal is 228.37 g/mol.
What is the IUPAC name of Palisandal?
The IUPAC name of Palisandal is 1,1-dimethoxycyclododecane.
What is the InChI of Palisandal?
The InChI of Palisandal is InChI=1S/C14H28O2/c1-15-14(16-2)12-10-8-6-4-3-5-7-9-11-13-14/h3-13H2,1-2H3.
What is the InChIKey of Palisandal?
The InChIKey of Palisandal is XXNCXSHVDVCRKB-UHFFFAOYSA-N.
What is the canonical SMILES of Palisandal?
The canonical SMILES of Palisandal is COC1(CCCCCCCCCCC1)OC.
What is the CAS number of Palisandal?
The CAS number of Palisandal is 950-33-4.
What is the Hydrogen Bond Donor Count of Palisandal?
The Hydrogen Bond Donor Count of Palisandal is 0.
Is Palisandal a canonicalized compound?
Yes, Palisandal is a canonicalized compound.