What is the molecular formula of 2-Methylbenzoxazole?
The molecular formula of 2-Methylbenzoxazole is C8H7NO.
What is the molecular weight of 2-Methylbenzoxazole?
The molecular weight of 2-Methylbenzoxazole is 133.15 g/mol.
What is the IUPAC name of 2-Methylbenzoxazole?
The IUPAC name of 2-Methylbenzoxazole is 2-methyl-1,3-benzoxazole.
What is the InChI of 2-Methylbenzoxazole?
The InChI of 2-Methylbenzoxazole is InChI=1S/C8H7NO/c1-6-9-7-4-2-3-5-8(7)10-6/h2-5H,1H3.
What is the InChIKey of 2-Methylbenzoxazole?
The InChIKey of 2-Methylbenzoxazole is DQSHFKPKFISSNM-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Methylbenzoxazole?
The canonical SMILES of 2-Methylbenzoxazole is CC1=NC2=CC=CC=C2O1.
What is the CAS number of 2-Methylbenzoxazole?
The CAS number of 2-Methylbenzoxazole is 95-21-6.
What is the EC number of 2-Methylbenzoxazole?
The EC number of 2-Methylbenzoxazole is 202-399-9.
What is the FEMA number of 2-Methylbenzoxazole?
The FEMA number of 2-Methylbenzoxazole is 4398.
Download
