What is the molecular weight of 2,4-Dichlorobenzylamine?
The molecular weight of 2,4-Dichlorobenzylamine is 176.04 g/mol.
What is the IUPAC name of 2,4-Dichlorobenzylamine?
The IUPAC name of 2,4-Dichlorobenzylamine is (2,4-dichlorophenyl)methanamine.
What is the InChI of 2,4-Dichlorobenzylamine?
The InChI of 2,4-Dichlorobenzylamine is InChI=1S/C7H7Cl2N/c8-6-2-1-5(4-10)7(9)3-6/h1-3H,4,10H2.
What is the InChIKey of 2,4-Dichlorobenzylamine?
The InChIKey of 2,4-Dichlorobenzylamine is SJUKJZSTBBSGHF-UHFFFAOYSA-N.
What is the canonical SMILES of 2,4-Dichlorobenzylamine?
The canonical SMILES of 2,4-Dichlorobenzylamine is C1=CC(=C(C=C1Cl)Cl)CN.
What is the CAS number of 2,4-Dichlorobenzylamine?
The CAS number of 2,4-Dichlorobenzylamine is 95-00-1.
What is the European Community (EC) number of 2,4-Dichlorobenzylamine?
The European Community (EC) number of 2,4-Dichlorobenzylamine is 202-382-6.
What is the UNII of 2,4-Dichlorobenzylamine?
The UNII of 2,4-Dichlorobenzylamine is TL3J7NC8YC.
What is the ChEMBL ID of 2,4-Dichlorobenzylamine?
The ChEMBL ID of 2,4-Dichlorobenzylamine is CHEMBL13094.
What is the molecular formula of 2,4-Dichlorobenzylamine?
The molecular formula of 2,4-Dichlorobenzylamine is C7H7Cl2N.