The molecular formula of the compound is C20H32O6.
What is the IUPAC name of the compound?
The IUPAC name of the compound is ethyl (E)-4-[(3aS,4R,7R,7aR)-7-(2-hydroxyethyl)spiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-4-yl]-3-methylbut-2-enoate.
What is the InChIKey of the compound?
The InChIKey of the compound is OHMPDEIJLFPZCQ-USDTXFSSSA-N.
What is the canonical SMILES representation of the compound?
The canonical SMILES representation of the compound is CCOC(=O)C=C(C)CC1C2C(C(CO1)CCO)OC3(O2)CCCCC3.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 2.8.
How many hydrogen bond donor atoms are in the compound?
There are 1 hydrogen bond donor atom in the compound.
How many hydrogen bond acceptor atoms are in the compound?
There are 6 hydrogen bond acceptor atoms in the compound.
How many rotatable bonds are in the compound?
There are 7 rotatable bonds in the compound.
What is the exact mass of the compound?
The exact mass of the compound is 368.21988874 g/mol.
Is the compound canonicalized?
Yes, the compound is canonicalized.
※ Please kindly note that our products are for research use only.