What is the PubChem CID of 2,5-Dimethyl-N-O-tolylaniline?
PubChem CID 71302426
What is the molecular formula of 2,5-Dimethyl-N-O-tolylaniline?
The molecular formula is C15H17N.
What are the synonyms for 2,5-Dimethyl-N-O-tolylaniline?
The synonyms are 2,5-Dimethyl-N-(o-tolyl)aniline, 949161-06-2, 2,5-dimethyl-N-o-tolylaniline, 2,5-Dimethyl-N-(2-methylphenyl)aniline, and SCHEMBL21241199.
What is the molecular weight of 2,5-Dimethyl-N-O-tolylaniline?
The molecular weight is 211.30 g/mol.
What is the IUPAC name of 2,5-Dimethyl-N-O-tolylaniline?
The IUPAC name is 2,5-dimethyl-N-(2-methylphenyl)aniline.
What is the InChI of 2,5-Dimethyl-N-O-tolylaniline?
The InChI is InChI=1S/C15H17N/c1-11-8-9-13(3)15(10-11)16-14-7-5-4-6-12(14)2/h4-10,16H,1-3H3.
What is the InChIKey of 2,5-Dimethyl-N-O-tolylaniline?
The InChIKey is QRKANGGXBGDSBC-UHFFFAOYSA-N.
What is the canonical SMILES of 2,5-Dimethyl-N-O-tolylaniline?
The canonical SMILES is CC1=CC(=C(C=C1)C)NC2=CC=CC=C2C.
What is the CAS number of 2,5-Dimethyl-N-O-tolylaniline?
The CAS number is 949161-06-2.
Is 2,5-Dimethyl-N-O-tolylaniline a canonicalized compound?
Yes, 2,5-Dimethyl-N-O-tolylaniline is a canonicalized compound.
※ Please kindly note that our products are for research use only.