What is the molecular formula of Boc-L-isoleucine amide?
The molecular formula of Boc-L-isoleucine amide is C11H22N2O3.
What is the molecular weight of Boc-L-isoleucine amide?
The molecular weight of Boc-L-isoleucine amide is 230.30 g/mol.
What is the IUPAC name of Boc-L-isoleucine amide?
The IUPAC name of Boc-L-isoleucine amide is tert-butyl N-[(2S,3S)-1-amino-3-methyl-1-oxopentan-2-yl]carbamate.
What is the InChI of Boc-L-isoleucine amide?
The InChI of Boc-L-isoleucine amide is InChI=1S/C11H22N2O3/c1-6-7(2)8(9(12)14)13-10(15)16-11(3,4)5/h7-8H,6H2,1-5H3,(H2,12,14)(H,13,15)/t7-,8-/m0/s1.
What is the InChIKey of Boc-L-isoleucine amide?
The InChIKey of Boc-L-isoleucine amide is ZXLNERXKXKBCJS-YUMQZZPRSA-N.
What is the canonical SMILES of Boc-L-isoleucine amide?
The canonical SMILES of Boc-L-isoleucine amide is CCC(C)C(C(=O)N)NC(=O)OC(C)(C)C.
What is the isomeric SMILES of Boc-L-isoleucine amide?
The isomeric SMILES of Boc-L-isoleucine amide is CC[C@H](C)[C@@H](C(=O)N)NC(=O)OC(C)(C)C.
What is the XLogP3 value of Boc-L-isoleucine amide?
The XLogP3 value of Boc-L-isoleucine amide is 1.4.
How many hydrogen bond donor counts does Boc-L-isoleucine amide have?
Boc-L-isoleucine amide has 2 hydrogen bond donor counts.
How many rotatable bond counts does Boc-L-isoleucine amide have?
Boc-L-isoleucine amide has 6 rotatable bond counts.