What is the molecular formula of 5-Allyl-6-methyluracil?
The molecular formula is C8H10N2O2.
When was 5-Allyl-6-methyluracil created in PubChem?
It was created on July 9, 2005.
What is the IUPAC name of 5-Allyl-6-methyluracil?
The IUPAC name is 6-methyl-5-prop-2-enyl-1H-pyrimidine-2,4-dione.
What is the InChI of 5-Allyl-6-methyluracil?
The InChI is InChI=1S/C8H10N2O2/c1-3-4-6-5(2)9-8(12)10-7(6)11/h3H,1,4H2,2H3,(H2,9,10,11,12).
What is the InChIKey of 5-Allyl-6-methyluracil?
The InChIKey is KWHYPGGBFHXFLD-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Allyl-6-methyluracil?
The canonical SMILES is CC1=C(C(=O)NC(=O)N1)CC=C.
What is the CAS number of 5-Allyl-6-methyluracil?
The CAS number is 94815-68-6.
What is the ChEMBL ID of 5-Allyl-6-methyluracil?
The ChEMBL ID is CHEMBL2131334.
What is the molecular weight of 5-Allyl-6-methyluracil?
The molecular weight is 166.18 g/mol.
Is 5-Allyl-6-methyluracil a canonicalized compound in PubChem?
Yes, it is canonicalized in PubChem.