What is the molecular formula of 1,2,4-Tri-iso-propylbenzene?
The molecular formula of 1,2,4-Tri-iso-propylbenzene is C15H24.
What are the synonyms of 1,2,4-Tri-iso-propylbenzene?
The synonyms of 1,2,4-Tri-iso-propylbenzene include 1,2,4-Triisopropylbenzene, 1,2,4-Tri-iso-propylbenzene, 1,2,4-Tri-isopropylbenzene, and Benzene, 1,2,4-tris(1-methylethyl)-.
What is the molecular weight of 1,2,4-Tri-iso-propylbenzene?
The molecular weight of 1,2,4-Tri-iso-propylbenzene is 204.35 g/mol.
When was 1,2,4-Tri-iso-propylbenzene created?
1,2,4-Tri-iso-propylbenzene was created on March 27, 2005.
When was 1,2,4-Tri-iso-propylbenzene last modified?
1,2,4-Tri-iso-propylbenzene was last modified on December 30, 2023.
What is the IUPAC name of 1,2,4-Tri-iso-propylbenzene?
The IUPAC name of 1,2,4-Tri-iso-propylbenzene is 1,2,4-tri(propan-2-yl)benzene.
What is the InChI code for 1,2,4-Tri-iso-propylbenzene?
The InChI code for 1,2,4-Tri-iso-propylbenzene is InChI=1S/C15H24/c1-10(2)13-7-8-14(11(3)4)15(9-13)12(5)6/h7-12H,1-6H3.
What is the InChIKey for 1,2,4-Tri-iso-propylbenzene?
The InChIKey for 1,2,4-Tri-iso-propylbenzene is RWGMANKDYBWNNP-UHFFFAOYSA-N.
What is the canonical SMILES representation of 1,2,4-Tri-iso-propylbenzene?
The canonical SMILES representation of 1,2,4-Tri-iso-propylbenzene is CC(C)C1=CC(=C(C=C1)C(C)C)C(C)C.
How many rotatable bonds does 1,2,4-Tri-iso-propylbenzene have?
1,2,4-Tri-iso-propylbenzene has 3 rotatable bonds.