What is the molecular formula of Chembrdg-bb 5224352?
The molecular formula of Chembrdg-bb 5224352 is C11H18ClN5O2.
What is the molecular weight of Chembrdg-bb 5224352?
The molecular weight of Chembrdg-bb 5224352 is 287.74 g/mol.
When was Chembrdg-bb 5224352 created in PubChem?
Chembrdg-bb 5224352 was created in PubChem on July 8, 2005.
When was Chembrdg-bb 5224352 last modified?
Chembrdg-bb 5224352 was last modified on December 30, 2023.
What is the IUPAC name of Chembrdg-bb 5224352?
The IUPAC name of Chembrdg-bb 5224352 is ethyl 2-[[4-(tert-butylamino)-6-chloro-1,3,5-triazin-2-yl]amino]acetate.
What is the InChI key of Chembrdg-bb 5224352?
The InChI key of Chembrdg-bb 5224352 is YNMJIBFWFJIUDR-UHFFFAOYSA-N.
What is the canonical SMILES representation of Chembrdg-bb 5224352?
The canonical SMILES representation of Chembrdg-bb 5224352 is CCOC(=O)CNC1=NC(=NC(=N1)Cl)NC(C)(C)C.
What is the ChEMBL ID of Chembrdg-bb 5224352?
The ChEMBL ID of Chembrdg-bb 5224352 is CHEMBL1702134.
What is the XLogP3-AA value of Chembrdg-bb 5224352?
The XLogP3-AA value of Chembrdg-bb 5224352 is 2.8.
What is the hydrogen bond donor count of Chembrdg-bb 5224352?
The hydrogen bond donor count of Chembrdg-bb 5224352 is 2.