What is the molecular formula of 1-Benzyl-3-methyl-2-pyrazolin-5-on?
The molecular formula is C11H12N2O.
What is the PubChem CID of 1-Benzyl-3-methyl-2-pyrazolin-5-on?
The PubChem CID is 70349.
What is the synonyms of 1-Benzyl-3-methyl-2-pyrazolin-5-on?
The synonyms include 946-23-6, 2-Pyrazolin-5-one, 1-benzyl-3-methyl-, 1-Benzyl-3-methyl-1H-pyrazol-5(4H)-one, 1-benzyl-3-methyl-2-pyrazolin-5-on, and 2-benzyl-5-methyl-4H-pyrazol-3-one.
What is the molecular weight of 1-Benzyl-3-methyl-2-pyrazolin-5-on?
The molecular weight is 188.23 g/mol.
What is the IUPAC name of 1-Benzyl-3-methyl-2-pyrazolin-5-on?
The IUPAC name is 2-benzyl-5-methyl-4H-pyrazol-3-one.
What is the InChI of 1-Benzyl-3-methyl-2-pyrazolin-5-on?
The InChI is InChI=1S/C11H12N2O/c1-9-7-11(14)13(12-9)8-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3.
What is the InChIKey of 1-Benzyl-3-methyl-2-pyrazolin-5-on?
The InChIKey is MEDQPHZEAUFCTK-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Benzyl-3-methyl-2-pyrazolin-5-on?
The canonical SMILES is CC1=NN(C(=O)C1)CC2=CC=CC=C2.
What is the CAS number of 1-Benzyl-3-methyl-2-pyrazolin-5-on?
The CAS number is 946-23-6.
Is 1-Benzyl-3-methyl-2-pyrazolin-5-on a canonicalized compound?
Yes, 1-Benzyl-3-methyl-2-pyrazolin-5-on is a canonicalized compound according to PubChem.
※ Please kindly note that our products are for research use only.