What is the molecular formula of (2R)-Bornane-10,2-sultam?
The molecular formula is C10H17NO2S.
What is the molecular weight of (2R)-Bornane-10,2-sultam?
The molecular weight is 215.31 g/mol.
What is the IUPAC name of (2R)-Bornane-10,2-sultam?
The IUPAC name is (5R)-10,10-dimethyl-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane 3,3-dioxide.
What is the InChI of (2R)-Bornane-10,2-sultam?
The InChI is InChI=1S/C10H17NO2S/c1-9(2)7-3-4-10(9)6-14(12,13)11-8(10)5-7/h7-8,11H,3-6H2,1-2H3/t7?,8-,10?/m1/s1.
What is the InChIKey of (2R)-Bornane-10,2-sultam?
The InChIKey is DPJYJNYYDJOJNO-CCNFQMFXSA-N.
What is the canonical SMILES of (2R)-Bornane-10,2-sultam?
The canonical SMILES is CC1(C2CCC13CS(=O)(=O)NC3C2)C.
What is the isomeric SMILES of (2R)-Bornane-10,2-sultam?
The isomeric SMILES is CC1(C2CCC13CS(=O)(=O)N[C@@H]3C2)C.
What is the CAS number of (2R)-Bornane-10,2-sultam?
The CAS number is 94594-90-8.
What is the EC number of (2R)-Bornane-10,2-sultam?
The EC number is 628-426-8.
Is (2R)-Bornane-10,2-sultam a canonicalized compound?
Yes, (2R)-Bornane-10,2-sultam is a canonicalized compound.