The molecular formula of the compound is C12H14N2Si.
What are the synonyms of the compound?
The synonyms of the compound are 7-[2-(Trimethylsilyl)ethynyl]-1H-indazole, 945761-98-8, 2-(1H-indazol-7-yl)ethynyl-trimethylsilane, and AKOS015914164.
What is the molecular weight of the compound?
The molecular weight of the compound is 214.34 g/mol.
When was the compound created and modified?
The compound was created on March 22, 2012, and it was last modified on December 30, 2023.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 2-(1H-indazol-7-yl)ethynyl-trimethylsilane.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C12H14N2Si/c1-15(2,3)8-7-10-5-4-6-11-9-13-14-12(10)11/h4-6,9H,1-3H3,(H,13,14).
What is the InChIKey of the compound?
The InChIKey of the compound is KBMJSOOMFKAPGF-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C[Si](C)(C)C#CC1=CC=CC2=C1NN=C2.
What is the hydrogen bond donor count of the compound?
The hydrogen bond donor count of the compound is 1.
What is the hydrogen bond acceptor count of the compound?
The hydrogen bond acceptor count of the compound is 1.
※ Please kindly note that our products are for research use only.