What is the molecular formula of thiabendazole?
The molecular formula of thiabendazole is C10H7N3S.
What is the molecular weight of thiabendazole?
The molecular weight of thiabendazole is 201.25 g/mol.
What is the IUPAC name of thiabendazole?
The IUPAC name of thiabendazole is 4-(1H-benzimidazol-2-yl)-1,3-thiazole.
What is the InChI of thiabendazole?
The InChI of thiabendazole is InChI=1S/C10H7N3S/c1-2-4-8-7(3-1)12-10(13-8)9-5-14-6-11-9/h1-6H,(H,12,13).
What is the InChIKey of thiabendazole?
The InChIKey of thiabendazole is WJCNZQLZVWNLKY-UHFFFAOYSA-N.
What is the canonical SMILES of thiabendazole?
The canonical SMILES of thiabendazole is C1=CC=C2C(=C1)NC(=N2)C3=CSC=N3.
What is the CAS number of thiabendazole?
The CAS number of thiabendazole is 148-79-8.
What is the UNII of thiabendazole?
The UNII of thiabendazole is N1Q45E87DT.
What is the ChEMBL ID of thiabendazole?
The ChEMBL ID of thiabendazole is CHEMBL625.
What is the Wikipedia page for thiabendazole?
The Wikipedia page for thiabendazole is "Tiabendazole".
What are the synonyms for thiabendazole?
The synonyms for thiabendazole include thiabendazole, 148-79-8, Tiabendazole, and Mintezol.
How does thiabendazole appear physically?
Thiabendazole appears as a white or cream-colored odorless, tasteless powder.
What is the main use of thiabendazole?
Thiabendazole is mainly used as a systemic fungicide and anthelmintic.
In what temperature range does thiabendazole sublime?
Thiabendazole sublimes above 590 °F.
What class of compounds does thiabendazole belong to?
Thiabendazole belongs to the class of benzimidazoles.
What diseases can thiabendazole control?
Thiabendazole can control a wide range of diseases including Aspergillus, Botrytis, Cladosporium, and Fusarium.
What are the chemical safety identifiers associated with thiabendazole?
The chemical safety identifiers associated with thiabendazole include CAS number (148-79-8), UN number (3077), and EC number (205-725-8).