What is the molecular formula of 7-Nitro-3-chromanone?
The molecular formula of 7-Nitro-3-chromanone is C9H7NO4.
When was 7-Nitro-3-chromanone created?
7-Nitro-3-chromanone was created on January 24, 2012.
What is the IUPAC name of 7-Nitro-3-chromanone?
The IUPAC name of 7-Nitro-3-chromanone is 7-nitro-4H-chromen-3-one.
What is the InChI of 7-Nitro-3-chromanone?
The InChI of 7-Nitro-3-chromanone is InChI=1S/C9H7NO4/c11-8-3-6-1-2-7(10(12)13)4-9(6)14-5-8/h1-2,4H,3,5H2.
What is the InChIKey of 7-Nitro-3-chromanone?
The InChIKey of 7-Nitro-3-chromanone is JXPVXYBZSVHUAV-UHFFFAOYSA-N.
What is the canonical SMILES of 7-Nitro-3-chromanone?
The canonical SMILES of 7-Nitro-3-chromanone is C1C(=O)COC2=C1C=CC(=C2)[N+](=O)[O-].
What is the molecular weight of 7-Nitro-3-chromanone?
The molecular weight of 7-Nitro-3-chromanone is 193.16 g/mol.
How many hydrogen bond donor counts does 7-Nitro-3-chromanone have?
7-Nitro-3-chromanone has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 7-Nitro-3-chromanone have?
7-Nitro-3-chromanone has 4 hydrogen bond acceptor counts.
Is 7-Nitro-3-chromanone a canonicalized compound?
Yes, 7-Nitro-3-chromanone is a canonicalized compound.