What is the molecular formula of 4-Nitronicotinaldehyde?
The molecular formula of 4-Nitronicotinaldehyde is C6H4N2O3.
What is the molecular weight of 4-Nitronicotinaldehyde?
The molecular weight of 4-Nitronicotinaldehyde is 152.11 g/mol.
What is the IUPAC name of 4-Nitronicotinaldehyde?
The IUPAC name of 4-Nitronicotinaldehyde is 4-nitropyridine-3-carbaldehyde.
What is the InChI of 4-Nitronicotinaldehyde?
The InChI of 4-Nitronicotinaldehyde is InChI=1S/C6H4N2O3/c9-4-5-3-7-2-1-6(5)8(10)11/h1-4H.
What is the InChIKey of 4-Nitronicotinaldehyde?
The InChIKey of 4-Nitronicotinaldehyde is JOCNJQYXCDLGRQ-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Nitronicotinaldehyde?
The canonical SMILES of 4-Nitronicotinaldehyde is C1=CN=CC(=C1[N+](=O)[O-])C=O.
What is the CAS number of 4-Nitronicotinaldehyde?
The CAS number of 4-Nitronicotinaldehyde is 944899-52-9.
What is the XLogP3-AA value of 4-Nitronicotinaldehyde?
The XLogP3-AA value of 4-Nitronicotinaldehyde is 0.1.
How many hydrogen bond acceptor count does 4-Nitronicotinaldehyde have?
4-Nitronicotinaldehyde has 4 hydrogen bond acceptor count.
How many rotatable bond count does 4-Nitronicotinaldehyde have?
4-Nitronicotinaldehyde has 1 rotatable bond count.
Download
