What is the molecular formula of Tri-O-acetyl-5-O-trityl-D-ribofuranose?
The molecular formula of Tri-O-acetyl-5-O-trityl-D-ribofuranose is C30H30O8.
When was Tri-O-acetyl-5-O-trityl-D-ribofuranose created in PubChem?
Tri-O-acetyl-5-O-trityl-D-ribofuranose was created in PubChem in 2009.
What is the molecular weight of Tri-O-acetyl-5-O-trityl-D-ribofuranose?
The molecular weight of Tri-O-acetyl-5-O-trityl-D-ribofuranose is 518.6 g/mol.
What is the IUPAC name of Tri-O-acetyl-5-O-trityl-D-ribofuranose?
The IUPAC name of Tri-O-acetyl-5-O-trityl-D-ribofuranose is [(2R,3R,4R)-4,5-diacetyloxy-2-(trityloxymethyl)oxolan-3-yl] acetate.
What is the Canonical SMILES representation of Tri-O-acetyl-5-O-trityl-D-ribofuranose?
The Canonical SMILES representation of Tri-O-acetyl-5-O-trityl-D-ribofuranose is CC(=O)OC1C(OC(C1OC(=O)C)OC(=O)C)COC(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.
How many hydrogen bond acceptors are present in Tri-O-acetyl-5-O-trityl-D-ribofuranose?
There are 8 hydrogen bond acceptors present in Tri-O-acetyl-5-O-trityl-D-ribofuranose.
What is the topological polar surface area of Tri-O-acetyl-5-O-trityl-D-ribofuranose?
The topological polar surface area of Tri-O-acetyl-5-O-trityl-D-ribofuranose is 97.4 Ų.
How many rotatable bond counts does Tri-O-acetyl-5-O-trityl-D-ribofuranose have?
Tri-O-acetyl-5-O-trityl-D-ribofuranose has 12 rotatable bond counts.
What is the XLogP3-AA value of Tri-O-acetyl-5-O-trityl-D-ribofuranose?
The XLogP3-AA value of Tri-O-acetyl-5-O-trityl-D-ribofuranose is 4.4.
How many defined atom stereocenter counts does Tri-O-acetyl-5-O-trityl-D-ribofuranose have?
Tri-O-acetyl-5-O-trityl-D-ribofuranose has 3 defined atom stereocenter counts.
※ Please kindly note that our products are for research use only.