What is the molecular formula of N-N-Octadecylurea?
The molecular formula of N-N-Octadecylurea is C19H40N2O.
What is the molecular weight of N-N-Octadecylurea?
The molecular weight of N-N-Octadecylurea is 312.5 g/mol.
What is the IUPAC name of N-N-Octadecylurea?
The IUPAC name of N-N-Octadecylurea is octadecylurea.
What is the InChI of N-N-Octadecylurea?
The InChI of N-N-Octadecylurea is InChI=1S/C19H40N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-19(20)22/h2-18H2,1H3,(H3,20,21,22).
What is the InChIKey of N-N-Octadecylurea?
The InChIKey of N-N-Octadecylurea is GJNDMSSZEBNLPU-UHFFFAOYSA-N.
What is the canonical SMILES of N-N-Octadecylurea?
The canonical SMILES of N-N-Octadecylurea is CCCCCCCCCCCCCCCCCCNC(=O)N.
What is the CAS number of N-N-Octadecylurea?
The CAS number of N-N-Octadecylurea is 2158-08-9.
What is the XLogP3-AA value of N-N-Octadecylurea?
The XLogP3-AA value of N-N-Octadecylurea is 7.8.
How many hydrogen bond donor counts does N-N-Octadecylurea have?
N-N-Octadecylurea has 2 hydrogen bond donor counts.
How many rotatable bond counts does N-N-Octadecylurea have?
N-N-Octadecylurea has 17 rotatable bond counts.