What is the molecular formula of Oct-7-enylsuccinic acid?
The molecular formula of Oct-7-enylsuccinic acid is C12H20O4.
What is the molecular weight of Oct-7-enylsuccinic acid?
The molecular weight of Oct-7-enylsuccinic acid is 228.28 g/mol.
What is the IUPAC Name of Oct-7-enylsuccinic acid?
The IUPAC Name of Oct-7-enylsuccinic acid is 2-oct-7-enylbutanedioic acid.
What is the InChI of Oct-7-enylsuccinic acid?
The InChI of Oct-7-enylsuccinic acid is InChI=1S/C12H20O4/c1-2-3-4-5-6-7-8-10(12(15)16)9-11(13)14/h2,10H,1,3-9H2,(H,13,14)(H,15,16).
What is the InChIKey of Oct-7-enylsuccinic acid?
The InChIKey of Oct-7-enylsuccinic acid is OFVPQIROYJTTQC-UHFFFAOYSA-N.
What is the canonical SMILES of Oct-7-enylsuccinic acid?
The canonical SMILES of Oct-7-enylsuccinic acid is C=CCCCCCCC(CC(=O)O)C(=O)O.
What is the CAS number of Oct-7-enylsuccinic acid?
The CAS number of Oct-7-enylsuccinic acid is 94386-55-7.
What is the European Community (EC) number of Oct-7-enylsuccinic acid?
The European Community (EC) number of Oct-7-enylsuccinic acid is 305-277-4.
What is the XLogP3-AA value of Oct-7-enylsuccinic acid?
The XLogP3-AA value of Oct-7-enylsuccinic acid is 2.9.
Is Oct-7-enylsuccinic acid a canonicalized compound?
Yes, Oct-7-enylsuccinic acid is a canonicalized compound.