What is the molecular formula of Butyl 2-(4-phenylphenoxy)propanoate?
The molecular formula of Butyl 2-(4-phenylphenoxy)propanoate is C19H22O3.
When was Butyl 2-(4-phenylphenoxy)propanoate created and modified?
Butyl 2-(4-phenylphenoxy)propanoate was created on 2005-03-26 and modified on 2023-12-30.
What is the molecular weight of Butyl 2-(4-phenylphenoxy)propanoate?
The molecular weight of Butyl 2-(4-phenylphenoxy)propanoate is 298.4 g/mol.
What is the IUPAC name of Butyl 2-(4-phenylphenoxy)propanoate?
The IUPAC name of Butyl 2-(4-phenylphenoxy)propanoate is butyl 2-(4-phenylphenoxy)propanoate.
What is the InChI of Butyl 2-(4-phenylphenoxy)propanoate?
The InChI of Butyl 2-(4-phenylphenoxy)propanoate is InChI=1S/C19H22O3/c1-3-4-14-21-19(20)15(2)22-18-12-10-17(11-13-18)16-8-6-5-7-9-16/h5-13,15H,3-4,14H2,1-2H3.
How many hydrogen bond donor counts does Butyl 2-(4-phenylphenoxy)propanoate have?
Butyl 2-(4-phenylphenoxy)propanoate has 0 hydrogen bond donor counts.
What is the XLogP3-AA value for Butyl 2-(4-phenylphenoxy)propanoate?
The XLogP3-AA value for Butyl 2-(4-phenylphenoxy)propanoate is 5.1.
What is the topological polar surface area of Butyl 2-(4-phenylphenoxy)propanoate?
The topological polar surface area of Butyl 2-(4-phenylphenoxy)propanoate is 35.5?2.
How many rotatable bond counts does Butyl 2-(4-phenylphenoxy)propanoate have?
Butyl 2-(4-phenylphenoxy)propanoate has 8 rotatable bond counts.
Is Butyl 2-(4-phenylphenoxy)propanoate a canonicalized compound?
Yes, Butyl 2-(4-phenylphenoxy)propanoate is a canonicalized compound.
※ Please kindly note that our products are for research use only.