What is the molecular formula of 3-Bromo-5-fluoropyridine?
The molecular formula is C5H3BrFN.
What is the molecular weight of 3-Bromo-5-fluoropyridine?
The molecular weight is 175.99 g/mol.
What is the IUPAC name of 3-Bromo-5-fluoropyridine?
The IUPAC name is 3-bromo-5-fluoropyridine.
What is the InChI of 3-Bromo-5-fluoropyridine?
The InChI is InChI=1S/C5H3BrFN/c6-4-1-5(7)3-8-2-4/h1-3H.
What is the InChIKey of 3-Bromo-5-fluoropyridine?
The InChIKey is HNNNBQRRIHKFLI-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Bromo-5-fluoropyridine?
The canonical SMILES is C1=C(C=NC=C1Br)F.
What is the CAS number of 3-Bromo-5-fluoropyridine?
The CAS number is 407-20-5.
What is the European Community (EC) Number of 3-Bromo-5-fluoropyridine?
The EC number is 627-401-9.
What is the DSSTox Substance ID of 3-Bromo-5-fluoropyridine?
The DSSTox Substance ID is DTXSID80356173.
Is 3-Bromo-5-fluoropyridine a canonicalized compound?
Yes, 3-Bromo-5-fluoropyridine is a canonicalized compound.