The molecular formula of the compound is C26H43BN2O5.
Are there any synonyms for the compound?
Yes, some synonyms for the compound include 943637-14-7, SCHEMBL14005281, and DTXSID20723426.
What is the molecular weight of the compound?
The molecular weight of the compound is 474.4 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is [6-[[3,3-dimethylbutan-2-yl(methyl)amino]methyl]-4-(3-hydroxy-3-methylbutyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C26H43BN2O5/c1-17(24(2,3)4)28(10)16-18-13-19(11-12-26(8,9)31)20-15-22(27(32)33)29(21(20)14-18)23(30)34-25(5,6)7/h13-15,17,31-33H,11-12,16H2,1-10H3.
What is the InChIKey of the compound?
The InChIKey of the compound is VWZDRKUIILQDLW-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is B(C1=CC2=C(C=C(C=C2N1C(=O)OC(C)(C)C)CN(C)C(C)C(C)(C)C)CCC(C)(C)O)(O)O.
How many hydrogen bond donor counts does the compound have?
The compound has 3 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does the compound have?
The compound has 6 hydrogen bond acceptor counts.
How many rotatable bond counts does the compound have?
The compound has 10 rotatable bond counts.
※ Please kindly note that our products are for research use only.