What is the molecular formula of 3-Methyl-3-thietanamine?
The molecular formula of 3-Methyl-3-thietanamine is C4H9NS.
What is the molecular weight of 3-Methyl-3-thietanamine?
The molecular weight of 3-Methyl-3-thietanamine is 103.19 g/mol.
What is the IUPAC name of 3-Methyl-3-thietanamine?
The IUPAC name of 3-Methyl-3-thietanamine is 3-methylthietan-3-amine.
What is the InChI of 3-Methyl-3-thietanamine?
The InChI of 3-Methyl-3-thietanamine is InChI=1S/C4H9NS/c1-4(5)2-6-3-4/h2-3,5H2,1H3.
What is the InChIKey of 3-Methyl-3-thietanamine?
The InChIKey of 3-Methyl-3-thietanamine is RBHLHYVXPUQTPN-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Methyl-3-thietanamine?
The canonical SMILES of 3-Methyl-3-thietanamine is CC1(CSC1)N.
What is the CAS number of 3-Methyl-3-thietanamine?
The CAS number of 3-Methyl-3-thietanamine is 943437-91-0.
What is the hydrogen bond donor count of 3-Methyl-3-thietanamine?
The hydrogen bond donor count of 3-Methyl-3-thietanamine is 1.
What is the hydrogen bond acceptor count of 3-Methyl-3-thietanamine?
The hydrogen bond acceptor count of 3-Methyl-3-thietanamine is 2.
Is 3-Methyl-3-thietanamine a canonicalized compound?
Yes, 3-Methyl-3-thietanamine is a canonicalized compound according to PubChem.