What is the molecular formula of the compound 3-Hydroxy-N-[2-(morpholino)ethyl]naphthalene-2-carboxamide hydrochloride?
The molecular formula is C17H21ClN2O3.
When was the compound created and last modified?
The compound was created on 2005-08-08 and last modified on 2023-12-30.
What is the molecular weight of the compound?
The molecular weight is 336.8 g/mol.
What are some synonyms for 3-Hydroxy-N-[2-(morpholino)ethyl]naphthalene-2-carboxamide hydrochloride?
Some synonyms include 3-Hydroxy-N-(2-(morpholino)ethyl)naphthalene-2-carboxamide hydrochloride and 3-hydroxy-N-(2-morpholin-4-ylethyl)naphthalene-2-carboxamide hydrochloride.
What are the component compounds of 3-Hydroxy-N-[2-(morpholino)ethyl]naphthalene-2-carboxamide hydrochloride?
The component compounds are Hydrochloric Acid and CID 3024329 (2-Naphthalenecarboxamide, 3-hydroxy-N-[2-(4-morpholinyl)ethyl]-).
What is the IUPAC name of the compound?
The IUPAC name is 3-hydroxy-N-(2-morpholin-4-ylethyl)naphthalene-2-carboxamide;hydrochloride.
What is the InChIKey of the compound?
The InChIKey is PLLOCNAZCZMBEV-UHFFFAOYSA-N.
What is the Canonical SMILES of the compound?
The Canonical SMILES is C1COCCN1CCNC(=O)C2=CC3=CC=CC=C3C=C2O.Cl.
How many hydrogen bond donor counts does the compound have?
The compound has 3 hydrogen bond donor counts.
Is the compound canonicalized?
Yes, the compound is canonicalized.
※ Please kindly note that our products are for research use only.
Download
![N-[2-[(2-Cyanoethyl)amino]ethyl]-N-[2-(stearoylamino)ethyl]stearamide](https://resource.alfa-chemistry.com/structure/94333-52-5.gif)
![1-[(7-Bromo-3-hydroxy-2-naphthyl)carbonyl]-4-methylpiperazinium chloride](https://resource.alfa-chemistry.com/structure/94333-53-6.gif)
![5-Fluoro-5,7,7-tris(trifluoromethyl)-6-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]-1,4-dioxepane](https://resource.alfa-chemistry.com/structure/94333-56-9.gif)
![Methanone,phenyl[6-(sulfooxy)-2-naphthalenyl]-,potassium salt(1:1)](https://resource.alfa-chemistry.com/structure/94333-61-6.gif)
