What is the molecular formula of o-(isopentyloxy)anisole?
The molecular formula of o-(isopentyloxy)anisole is C12H18O2.
When was o-(isopentyloxy)anisole first created according to PubChem?
o-(isopentyloxy)anisole was first created in 2005-08-08.
What is the IUPAC name of o-(isopentyloxy)anisole?
The IUPAC name of o-(isopentyloxy)anisole is 1-methoxy-2-(3-methylbutoxy)benzene.
What is the InChI of o-(isopentyloxy)anisole?
The InChI of o-(isopentyloxy)anisole is InChI=1S/C12H18O2/c1-10(2)8-9-14-12-7-5-4-6-11(12)13-3/h4-7,10H,8-9H2,1-3H3.
What is the molecular weight of o-(isopentyloxy)anisole?
The molecular weight of o-(isopentyloxy)anisole is 194.27 g/mol.
What is the Canonical SMILES of o-(isopentyloxy)anisole?
The Canonical SMILES of o-(isopentyloxy)anisole is CC(C)CCOC1=CC=CC=C1OC.
How many hydrogen bond acceptor counts are there in o-(isopentyloxy)anisole?
There are 2 hydrogen bond acceptor counts in o-(isopentyloxy)anisole.
What is the XLogP3 value of o-(isopentyloxy)anisole?
The XLogP3 value of o-(isopentyloxy)anisole is 3.3.
Is o-(isopentyloxy)anisole a covalently-bonded unit?
Yes, o-(isopentyloxy)anisole is a covalently-bonded unit.
How many rotatable bond counts are there in o-(isopentyloxy)anisole?
There are 5 rotatable bond counts in o-(isopentyloxy)anisole.