What is the PubChem CID of Diisohexyl maleate?
PubChem CID 6433036
What is the molecular formula of Diisohexyl maleate?
C16H28O4
What are the synonyms for Diisohexyl maleate?
Diisohexyl maleate, EINECS 304-352-9, 94248-78-9, SCHEMBL6903301
What is the molecular weight of Diisohexyl maleate?
The molecular weight is 284.39 g/mol.
What is the IUPAC name of Diisohexyl maleate?
The IUPAC name is bis(4-methylpentyl) (Z)-but-2-enedioate.
What is the InChI of Diisohexyl maleate?
The InChI is InChI=1S/C16H28O4/c1-13(2)7-5-11-19-15(17)9-10-16(18)20-12-6-8-14(3)4/h9-10,13-14H,5-8,11-12H2,1-4H3/b10-9-.
What is the InChIKey of Diisohexyl maleate?
The InChIKey is AUUKMDXZUNSGGI-KTKRTIGZSA-N.
What is the canonical SMILES of Diisohexyl maleate?
The canonical SMILES is CC(C)CCCOC(=O)C=CC(=O)OCCCC(C)C.
What is the CAS number of Diisohexyl maleate?
The CAS number is 94248-78-9.
Is Diisohexyl maleate a canonicalized compound?
Yes, Diisohexyl maleate is canonicalized.