What is the PubChem CID for tert-Potassium decanoate?
PubChem CID 71300538.
What is the molecular formula of tert-Potassium decanoate?
The molecular formula is C10H19KO2.
What are the synonyms for tert-Potassium decanoate?
The synonyms are tert-Potassium decanoate, EINECS 304-348-7, 94248-74-5, and DTXSID00241294.
What is the molecular weight of tert-Potassium decanoate?
The molecular weight is 210.35 g/mol.
What is the parent compound of tert-Potassium decanoate?
The parent compound is CID 55250610 (6,6-Dimethyloctanoic acid).
What are the component compounds of tert-Potassium decanoate?
The component compounds are CID 55250610 (6,6-Dimethyloctanoic acid) and CID 5462222 (Potassium).
When was tert-Potassium decanoate created?
It was created on April 19, 2013.
When was tert-Potassium decanoate last modified?
It was last modified on December 30, 2023.
What is the IUPAC name of tert-Potassium decanoate?
The IUPAC name is potassium;6,6-dimethyloctanoate.
What is the Canonical SMILES of tert-Potassium decanoate?
The Canonical SMILES is CCC(C)(C)CCCCC(=O)[O-].[K+].