What is the molecular formula of Isopentyl-2-benzopyrone?
The molecular formula of Isopentyl-2-benzopyrone is C14H16O2.
What is the molecular weight of Isopentyl-2-benzopyrone?
The molecular weight of Isopentyl-2-benzopyrone is 216.27 g/mol.
When was Isopentyl-2-benzopyrone created in PubChem?
Isopentyl-2-benzopyrone was created in PubChem on August 20, 2009.
What is the IUPAC name of Isopentyl-2-benzopyrone?
The IUPAC name of Isopentyl-2-benzopyrone is 3-(3-methylbutyl)chromen-2-one.
What is the Canonical SMILES representation of Isopentyl-2-benzopyrone?
The Canonical SMILES representation of Isopentyl-2-benzopyrone is CC(C)CCC1=CC2=CC=CC=C2OC1=O.
What is the InChIKey of Isopentyl-2-benzopyrone?
The InChIKey of Isopentyl-2-benzopyrone is MUTDFGUDDPWCGY-UHFFFAOYSA-N.
How many hydrogen bond acceptor counts does Isopentyl-2-benzopyrone have?
Isopentyl-2-benzopyrone has 2 hydrogen bond acceptor counts.
What is the topological polar surface area of Isopentyl-2-benzopyrone?
The topological polar surface area of Isopentyl-2-benzopyrone is 26.3 Ų.
How many rotatable bond counts does Isopentyl-2-benzopyrone have?
Isopentyl-2-benzopyrone has 3 rotatable bond counts.
Is Isopentyl-2-benzopyrone a canonicalized compound?
Yes, Isopentyl-2-benzopyrone is a canonicalized compound in PubChem.
Download
![[[(Methyltetradecyl)oxy]methyl]oxirane](https://resource.alfa-chemistry.com/structure/94247-83-3.gif)
![[[(Methyldodecyl)oxy]methyl]oxirane](https://resource.alfa-chemistry.com/structure/94247-84-4.gif)
