What is the molecular formula of L-Lysine L-ascorbate?
The molecular formula of L-Lysine L-ascorbate is C12H22N2O8.
What are the synonyms for L-Lysine L-ascorbate?
The synonyms for L-Lysine L-ascorbate are Lysine ascorbate, 94231-35-3, and UNII-29X3TZ9A0M.
What is the molecular weight of L-Lysine L-ascorbate?
The molecular weight of L-Lysine L-ascorbate is 322.31 g/mol.
What are the component compounds of L-Lysine L-ascorbate?
The component compounds of L-Lysine L-ascorbate are Ascorbic Acid (CID 54670067) and Lysine (CID 5962).
What is the IUPAC name of L-Lysine L-ascorbate?
The IUPAC name of L-Lysine L-ascorbate is (2S)-2,6-diaminohexanoic acid;(2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one.
What is the InChI of L-Lysine L-ascorbate?
The InChI of L-Lysine L-ascorbate is InChI=1S/C6H14N2O2.C6H8O6/c7-4-2-1-3-5(8)6(9)10;7-1-2(8)5-3(9)4(10)6(11)12-5/h5H,1-4,7-8H2,(H,9,10);2,5,7-10H,1H2/t5-;2-,5+/m00/s1.
What is the InChIKey of L-Lysine L-ascorbate?
The InChIKey of L-Lysine L-ascorbate is QPNXLUIFXPXQCB-BHQVQWGSSA-N.
What is the canonical SMILES of L-Lysine L-ascorbate?
The canonical SMILES of L-Lysine L-ascorbate is C(CCN)CC(C(=O)O)N.C(C(C1C(=C(C(=O)O1)O)O)O)O.
What is the CAS number of L-Lysine L-ascorbate?
The CAS number of L-Lysine L-ascorbate is 94231-35-3.
What is the European Community (EC) number of L-Lysine L-ascorbate?
The European Community (EC) number of L-Lysine L-ascorbate is 303-851-9.