What is the molecular formula of 5-Methoxymethyl-du cep?
The molecular formula of 5-Methoxymethyl-du cep is C41H51N4O9P.
When was 5-Methoxymethyl-du cep created?
5-Methoxymethyl-du cep was created on February 16, 2015.
What is the IUPAC name of 5-Methoxymethyl-du cep?
The IUPAC name of 5-Methoxymethyl-du cep is 3-[[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[5-(methoxymethyl)-2,4-dioxopyrimidin-1-yl]oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile.
What is the InChIKey of 5-Methoxymethyl-du cep?
The InChIKey of 5-Methoxymethyl-du cep is PBNTXMNQZGREOR-OSHXEJAZSA-N.
What is the canonical SMILES of 5-Methoxymethyl-du cep?
The canonical SMILES of 5-Methoxymethyl-du cep is CC(C)N(C(C)C)P(OCCC#N)OC1CC(OC1COC(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)C4=CC=C(C=C4)OC)N5C=C(C(=O)NC5=O)COC.
What is the molecular weight of 5-Methoxymethyl-du cep?
The molecular weight of 5-Methoxymethyl-du cep is 774.8 g/mol.
What is the XLogP3-AA value of 5-Methoxymethyl-du cep?
The XLogP3-AA value of 5-Methoxymethyl-du cep is 4.9.
How many hydrogen bond donor counts does 5-Methoxymethyl-du cep have?
5-Methoxymethyl-du cep has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 5-Methoxymethyl-du cep have?
5-Methoxymethyl-du cep has 11 hydrogen bond acceptor counts.
How many rotatable bond counts does 5-Methoxymethyl-du cep have?
5-Methoxymethyl-du cep has 19 rotatable bond counts.