What is the molecular formula of 2-Octadecylfumaric acid?
The molecular formula of 2-Octadecylfumaric acid is C22H40O4.
What is the molecular weight of 2-Octadecylfumaric acid?
The molecular weight of 2-Octadecylfumaric acid is 368.5 g/mol.
What is the IUPAC name of 2-Octadecylfumaric acid?
The IUPAC name of 2-Octadecylfumaric acid is (E)-2-octadecylbut-2-enedioic acid.
What is the InChI of 2-Octadecylfumaric acid?
The InChI of 2-Octadecylfumaric acid is InChI=1S/C22H40O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20(22(25)26)19-21(23)24/h19H,2-18H2,1H3,(H,23,24)(H,25,26)/b20-19+.
What is the InChIKey of 2-Octadecylfumaric acid?
The InChIKey of 2-Octadecylfumaric acid is DORSXXCBNVVKKP-FMQUCBEESA-N.
What is the canonical SMILES of 2-Octadecylfumaric acid?
The canonical SMILES of 2-Octadecylfumaric acid is CCCCCCCCCCCCCCCCC(=CC(=O)O)C(=O)O.
What is the CAS number of 2-Octadecylfumaric acid?
The CAS number of 2-Octadecylfumaric acid is 94213-56-6.
What is the European Community (EC) number of 2-Octadecylfumaric acid?
The European Community (EC) number of 2-Octadecylfumaric acid is 303-760-4.
Is 2-Octadecylfumaric acid a canonicalized compound?
Yes, 2-Octadecylfumaric acid is a canonicalized compound.