What is the molecular formula of Piroxicam-d3?
The molecular formula of Piroxicam-d3 is C15H13N3O4S.
What is the molecular weight of Piroxicam-d3?
The molecular weight of Piroxicam-d3 is 334.4 g/mol.
What is the IUPAC name of Piroxicam-d3?
The IUPAC name of Piroxicam-d3 is 4-hydroxy-1,1-dioxo-N-pyridin-2-yl-2-(trideuteriomethyl)-1λ6,2-benzothiazine-3-carboxamide.
What is the InChI of Piroxicam-d3?
The InChI of Piroxicam-d3 is InChI=1S/C15H13N3O4S/c1-18-13(15(20)17-12-8-4-5-9-16-12)14(19)10-6-2-3-7-11(10)23(18,21)22/h2-9,19H,1H3,(H,16,17,20)/i1D3.
What is the InChIKey of Piroxicam-d3?
The InChIKey of Piroxicam-d3 is QYSPLQLAKJAUJT-FIBGUPNXSA-N.
What is the canonical SMILES of Piroxicam-d3?
The canonical SMILES of Piroxicam-d3 is CN1C(=C(C2=CC=CC=C2S1(=O)=O)O)C(=O)NC3=CC=CC=N3.
What is the CAS number of Piroxicam-d3?
The CAS number of Piroxicam-d3 is 942047-64-5.
What is the European Community (EC) number of Piroxicam-d3?
The European Community (EC) number of Piroxicam-d3 is 804-623-6.
What is the DSSTox Substance ID of Piroxicam-d3?
The DSSTox Substance ID of Piroxicam-d3 is DTXSID90715737.
What is the XLogP3 value of Piroxicam-d3?
The XLogP3 value of Piroxicam-d3 is 3.1.