What is the molecular formula of Bornyl 2-methylbutyrate?
The molecular formula of Bornyl 2-methylbutyrate is C15H26O2.
What are some synonyms of Bornyl 2-methylbutyrate?
Some synonyms of Bornyl 2-methylbutyrate are Isobornyl 2-methylbutyrate and 94200-10-9.
What is the molecular weight of Bornyl 2-methylbutyrate?
The molecular weight of Bornyl 2-methylbutyrate is 238.37 g/mol.
When was Bornyl 2-methylbutyrate created in the database?
Bornyl 2-methylbutyrate was created in the database on December 5, 2007.
What is the InChIKey of Bornyl 2-methylbutyrate?
The InChIKey of Bornyl 2-methylbutyrate is CEVCMCWHMHJEQS-UHFFFAOYSA-N.
What is the Canonical SMILES of Bornyl 2-methylbutyrate?
The Canonical SMILES of Bornyl 2-methylbutyrate is CCC(C)C(=O)OC1CC2CCC1(C2(C)C)C.
What is the CAS number of Bornyl 2-methylbutyrate?
The CAS number of Bornyl 2-methylbutyrate is 94200-10-9.
What is the XLogP3-AA value of Bornyl 2-methylbutyrate?
The XLogP3-AA value of Bornyl 2-methylbutyrate is 4.5.
How many hydrogen bond acceptors does Bornyl 2-methylbutyrate have?
Bornyl 2-methylbutyrate has 2 hydrogen bond acceptors.
How many rotatable bond counts does Bornyl 2-methylbutyrate have?
Bornyl 2-methylbutyrate has 4 rotatable bond counts.
Download
