What is the molecular formula of Acetoxime benzoate?
The molecular formula of Acetoxime benzoate is C10H11NO2.
What are the synonyms of Acetoxime benzoate?
The synonyms of Acetoxime benzoate include O-Benzoylacetoxime, Propan-2-one O-benzoyl oxime, and (propan-2-ylideneamino) benzoate.
What is the molecular weight of Acetoxime benzoate?
The molecular weight of Acetoxime benzoate is 177.20 g/mol.
When was Acetoxime benzoate created and modified?
Acetoxime benzoate was created on 2005-03-27 and last modified on 2023-12-30.
What is the IUPAC name of Acetoxime benzoate?
The IUPAC name of Acetoxime benzoate is (propan-2-ylideneamino) benzoate.
What is the InChI of Acetoxime benzoate?
The InChI of Acetoxime benzoate is InChI=1S/C10H11NO2/c1-8(2)11-13-10(12)9-6-4-3-5-7-9/h3-7H,1-2H3.
What is the InChIKey of Acetoxime benzoate?
The InChIKey of Acetoxime benzoate is CTIVZNURROIUHT-UHFFFAOYSA-N.
What is the canonical SMILES of Acetoxime benzoate?
The canonical SMILES of Acetoxime benzoate is CC(=NOC(=O)C1=CC=CC=C1)C.
What is the XLogP3-AA value of Acetoxime benzoate?
The XLogP3-AA value of Acetoxime benzoate is 2.
How many hydrogen bond donor counts does Acetoxime benzoate have?
Acetoxime benzoate has 0 hydrogen bond donor count.
Download
![N-[(1-Ethyl-3,5-dimethyl-1H-pyrazol-4-yl)methyl]-ethanamine](https://resource.alfa-chemistry.com/structure/942852-84-8.gif)
