What is the molecular formula of 3-Acetyl-2-bromopyridine?
The molecular formula of 3-Acetyl-2-bromopyridine is C7H6BrNO.
What is the molecular weight of 3-Acetyl-2-bromopyridine?
The molecular weight of 3-Acetyl-2-bromopyridine is 200.03 g/mol.
What is the IUPAC name of 3-Acetyl-2-bromopyridine?
The IUPAC name of 3-Acetyl-2-bromopyridine is 1-(2-bromopyridin-3-yl)ethanone.
What is the InChI of 3-Acetyl-2-bromopyridine?
The InChI of 3-Acetyl-2-bromopyridine is InChI=1S/C7H6BrNO/c1-5(10)6-3-2-4-9-7(6)8/h2-4H,1H3.
What is the InChIKey of 3-Acetyl-2-bromopyridine?
The InChIKey of 3-Acetyl-2-bromopyridine is VYJZSPNXTDPUJW-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Acetyl-2-bromopyridine?
The canonical SMILES of 3-Acetyl-2-bromopyridine is CC(=O)C1=C(N=CC=C1)Br.
What is the CAS number of 3-Acetyl-2-bromopyridine?
The CAS number of 3-Acetyl-2-bromopyridine is 84199-61-1.
What is the XLogP3-AA value of 3-Acetyl-2-bromopyridine?
The XLogP3-AA value of 3-Acetyl-2-bromopyridine is 1.6.
How many hydrogen bond acceptors are there in 3-Acetyl-2-bromopyridine?
There are 2 hydrogen bond acceptors in 3-Acetyl-2-bromopyridine.
How many rotatable bonds are there in 3-Acetyl-2-bromopyridine?
There is 1 rotatable bond in 3-Acetyl-2-bromopyridine.