What is the molecular formula of Pentafluorophenyl 5-pyrid-3-ylthiophene-2-carboxylate?
The molecular formula is C16H6F5NO2S.
What are some synonyms for Pentafluorophenyl 5-pyrid-3-ylthiophene-2-carboxylate?
Some synonyms include 941716-94-5, (2,3,4,5,6-pentafluorophenyl) 5-pyridin-3-ylthiophene-2-carboxylate, and Perfluorophenyl 5-(pyridin-3-yl)thiophene-2-carboxylate.
When was Pentafluorophenyl 5-pyrid-3-ylthiophene-2-carboxylate created and last modified?
It was created on 2009-07-21 and last modified on 2023-12-30.
What is the molecular weight of Pentafluorophenyl 5-pyrid-3-ylthiophene-2-carboxylate?
The molecular weight is 371.3 g/mol.
What is the IUPAC name of Pentafluorophenyl 5-pyrid-3-ylthiophene-2-carboxylate?
The IUPAC name is (2,3,4,5,6-pentafluorophenyl) 5-pyridin-3-ylthiophene-2-carboxylate.
What is the Canonical SMILES representation of Pentafluorophenyl 5-pyrid-3-ylthiophene-2-carboxylate?
The Canonical SMILES representation is C1=CC(=CN=C1)C2=CC=C(S2)C(=O)OC3=C(C(=C(C(=C3F)F)F)F)F.
How many hydrogen bond acceptors are present in Pentafluorophenyl 5-pyrid-3-ylthiophene-2-carboxylate?
There are 9 hydrogen bond acceptors.
What is the topological polar surface area of Pentafluorophenyl 5-pyrid-3-ylthiophene-2-carboxylate?
The topological polar surface area is 67.4 Ų.
How many rotatable bonds are there in Pentafluorophenyl 5-pyrid-3-ylthiophene-2-carboxylate?
There are 4 rotatable bonds.
Is Pentafluorophenyl 5-pyrid-3-ylthiophene-2-carboxylate considered a canonicalized compound?
Yes, it is considered a canonicalized compound according to PubChem.
※ Please kindly note that our products are for research use only.
Download
![3-[(6-Methylpyrazin-2-yl)oxy]benzylamine 97%](https://resource.alfa-chemistry.com/structure/941716-89-8.gif)
