What is the molecular formula of 3-[p-(Hexyloxy)phenyl]propionic anhydride?
The molecular formula is C30H42O5.
When was the compound created and last modified?
The compound was created on 2007-12-05 and last modified on 2023-12-30.
What is the IUPAC Name of 3-[p-(Hexyloxy)phenyl]propionic anhydride?
The IUPAC Name is 3-(4-hexoxyphenyl)propanoyl or 3-(4-hexoxyphenyl)propanoate.
What is the InChI of 3-[p-(Hexyloxy)phenyl]propionic anhydride?
The InChI is InChI=1S/C30H42O5/c1-3-5-7-9-23-33-27-17-11-25(12-18-27)15-21-29(31)35-30(32)22-16-26-13-19-28(20-14-26)34-24-10-8-6-4-2/h11-14,17-20H,3-10,15-16,21-24H2,1-2H3.
What is the Canonical SMILES of 3-[p-(Hexyloxy)phenyl]propionic anhydride?
The Canonical SMILES is CCCCCCOC1=CC=C(C=C1)CCC(=O)OC(=O)CCC2=CC=C(C=C2)OCCCCCC.
What is the molecular weight of 3-[p-(Hexyloxy)phenyl]propionic anhydride?
The molecular weight is 482.6 g/mol.
How many hydrogen bond donor counts does 3-[p-(Hexyloxy)phenyl]propionic anhydride have?
It has 0 hydrogen bond donor counts.
What is the exact mass of 3-[p-(Hexyloxy)phenyl]propionic anhydride?
The exact mass is 482.30322444 g/mol.
How many rotatable bond counts does 3-[p-(Hexyloxy)phenyl]propionic anhydride have?
It has 20 rotatable bond counts.
Is the compound canonicalized?
Yes, the compound is canonicalized according to PubChem.
※ Please kindly note that our products are for research use only.