What is the molecular formula of Hex-3-enyl(Z)-cinnamate?
The molecular formula of Hex-3-enyl(Z)-cinnamate is C15H18O2.
What is the molecular weight of Hex-3-enyl(Z)-cinnamate?
The molecular weight of Hex-3-enyl(Z)-cinnamate is 230.30 g/mol.
What is the IUPAC name of Hex-3-enyl(Z)-cinnamate?
The IUPAC name of Hex-3-enyl(Z)-cinnamate is [(Z)-hex-3-enyl] (E)-3-phenylprop-2-enoate.
What is the InChI of Hex-3-enyl(Z)-cinnamate?
The InChI of Hex-3-enyl(Z)-cinnamate is InChI=1S/C15H18O2/c1-2-3-4-8-13-17-15(16)12-11-14-9-6-5-7-10-14/h3-7,9-12H,2,8,13H2,1H3/b4-3-,12-11+.
What is the InChIKey of Hex-3-enyl(Z)-cinnamate?
The InChIKey of Hex-3-enyl(Z)-cinnamate is FKWGVMQNGUQXDN-FECXASIGSA-N.
What is the canonical SMILES of Hex-3-enyl(Z)-cinnamate?
The canonical SMILES of Hex-3-enyl(Z)-cinnamate is CCC=CCCOC(=O)C=CC1=CC=CC=C1.
What is the isomeric SMILES of Hex-3-enyl(Z)-cinnamate?
The isomeric SMILES of Hex-3-enyl(Z)-cinnamate is CC/C=C\CCOC(=O)/C=C/C1=CC=CC=C1.
What is the XLogP3 value of Hex-3-enyl(Z)-cinnamate?
The XLogP3 value of Hex-3-enyl(Z)-cinnamate is 4.4.
How many hydrogen bond donor counts does Hex-3-enyl(Z)-cinnamate have?
Hex-3-enyl(Z)-cinnamate has 0 hydrogen bond donor count.
How many rotatable bond counts does Hex-3-enyl(Z)-cinnamate have?
Hex-3-enyl(Z)-cinnamate has 7 rotatable bond counts.