What is the molecular formula of Purpurin 1-methyl ether?
The molecular formula of Purpurin 1-methyl ether is C15H10O5.
What is the molecular weight of Purpurin 1-methyl ether?
The molecular weight of Purpurin 1-methyl ether is 270.24 g/mol.
In which organisms can Purpurin 1-methyl ether be found?
Purpurin 1-methyl ether can be found in Galium spurium, Cinchona calisaya, and other organisms with available data.
What is the IUPAC name of Purpurin 1-methyl ether?
The IUPAC name of Purpurin 1-methyl ether is 2,4-dihydroxy-1-methoxyanthracene-9,10-dione.
What is the InChIKey of Purpurin 1-methyl ether?
The InChIKey of Purpurin 1-methyl ether is NLORVHQRZMJFEZ-UHFFFAOYSA-N.
What is the Canonical SMILES representation of Purpurin 1-methyl ether?
The Canonical SMILES representation of Purpurin 1-methyl ether is COC1=C(C=C(C2=C1C(=O)C3=CC=CC=C3C2=O)O)O.
What is the XLogP3-AA value of Purpurin 1-methyl ether?
The XLogP3-AA value of Purpurin 1-methyl ether is 2.7.
How many hydrogen bond donor counts does Purpurin 1-methyl ether have?
Purpurin 1-methyl ether has 2 hydrogen bond donor counts.
What is the topological polar surface area of Purpurin 1-methyl ether?
The topological polar surface area of Purpurin 1-methyl ether is 83.8 Ų.
Is the compound is canonicalized?
Yes, the compound is canonicalized.