What is the molecular formula of 2-Ethylundecyl formate?
The molecular formula of 2-Ethylundecyl formate is C14H28O2.
What is the molecular weight of 2-Ethylundecyl formate?
The molecular weight of 2-Ethylundecyl formate is 228.37 g/mol.
What is the IUPAC name of 2-Ethylundecyl formate?
The IUPAC name of 2-Ethylundecyl formate is 2-ethylundecyl formate.
What is the InChI of 2-Ethylundecyl formate?
The InChI of 2-Ethylundecyl formate is InChI=1S/C14H28O2/c1-3-5-6-7-8-9-10-11-14(4-2)12-16-13-15/h13-14H,3-12H2,1-2H3.
What is the InChIKey of 2-Ethylundecyl formate?
The InChIKey of 2-Ethylundecyl formate is UEOVEXIOAPBXAW-UHFFFAOYSA-N.
How many hydrogen bond donor count does 2-Ethylundecyl formate have?
2-Ethylundecyl formate has 0 hydrogen bond donor count.
What is the exact mass of 2-Ethylundecyl formate?
The exact mass of 2-Ethylundecyl formate is 228.208930132 g/mol.
How many hydrogen bond acceptor count does 2-Ethylundecyl formate have?
2-Ethylundecyl formate has 2 hydrogen bond acceptor count.
How many rotatable bond count does 2-Ethylundecyl formate have?
2-Ethylundecyl formate has 12 rotatable bond count.
Is 2-Ethylundecyl formate a canonicalized compound?
Yes, 2-Ethylundecyl formate is a canonicalized compound.