What is the molecular formula of 2,5-Diethoxyaniline?
The molecular formula of 2,5-Diethoxyaniline is C10H15NO2.
What is the molecular weight of 2,5-Diethoxyaniline?
The molecular weight of 2,5-Diethoxyaniline is 181.23 g/mol.
What is the IUPAC name of 2,5-Diethoxyaniline?
The IUPAC name of 2,5-Diethoxyaniline is 2,5-diethoxyaniline.
What is the InChI of 2,5-Diethoxyaniline?
The InChI of 2,5-Diethoxyaniline is InChI=1S/C10H15NO2/c1-3-12-8-5-6-10(13-4-2)9(11)7-8/h5-7H,3-4,11H2,1-2H3.
What is the InChIKey of 2,5-Diethoxyaniline?
The InChIKey of 2,5-Diethoxyaniline is XPKFTIYOZUJAGA-UHFFFAOYSA-N.
What is the canonical SMILES of 2,5-Diethoxyaniline?
The canonical SMILES of 2,5-Diethoxyaniline is CCOC1=CC(=C(C=C1)OCC)N.
What is the CAS number of 2,5-Diethoxyaniline?
The CAS number of 2,5-Diethoxyaniline is 94-85-9.
What is the EC number of 2,5-Diethoxyaniline?
The EC number of 2,5-Diethoxyaniline is 202-369-5.
What is the UNII of 2,5-Diethoxyaniline?
The UNII of 2,5-Diethoxyaniline is CF3F7MAQ35.
Is 2,5-Diethoxyaniline a canonicalized compound?
Yes, 2,5-Diethoxyaniline is a canonicalized compound.