What is the molecular formula of 2-Allylcyclohexanone?
The molecular formula of 2-Allylcyclohexanone is C9H14O.
What is the molecular weight of 2-Allylcyclohexanone?
The molecular weight of 2-Allylcyclohexanone is 138.21 g/mol.
What is the IUPAC name of 2-Allylcyclohexanone?
The IUPAC name of 2-Allylcyclohexanone is 2-prop-2-enylcyclohexan-1-one.
What is the InChI of 2-Allylcyclohexanone?
The InChI of 2-Allylcyclohexanone is InChI=1S/C9H14O/c1-2-5-8-6-3-4-7-9(8)10/h2,8H,1,3-7H2.
What is the InChIKey of 2-Allylcyclohexanone?
The InChIKey of 2-Allylcyclohexanone is UPGHEUSRLZSXAE-UHFFFAOYSA-N.
What is the Canonical SMILES of 2-Allylcyclohexanone?
The Canonical SMILES of 2-Allylcyclohexanone is C=CCC1CCCCC1=O.
What is the CAS number of 2-Allylcyclohexanone?
The CAS number of 2-Allylcyclohexanone is 94-66-6.
What is the XLogP3-AA value of 2-Allylcyclohexanone?
The XLogP3-AA value of 2-Allylcyclohexanone is 2.1.
How many hydrogen bond donor counts does 2-Allylcyclohexanone have?
2-Allylcyclohexanone has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 2-Allylcyclohexanone have?
2-Allylcyclohexanone has 1 hydrogen bond acceptor count.